methyl 2-methyl-5-iodobenzoate

methyl 2-methyl-5-iodobenzoate - Names and Identifiers

Name	methyl 5-iodo-2-methylbenzoate
Synonyms	methyl 5-iodo-2-methylbenzoate Methyl 5-iodo-2-Methylbenzoate 5-IODO-2-METHYL-, METHYL ESTER Methyl 2-methyl-5-iodobenzoate methyl 2-methyl-5-iodobenzoate 5-iodo-2-Methylbenzoic acid Methyl ester BENZOIC ACID, 5-IODO-2-METHYL-, METHYL ESTER benzoic acid, 5-iodo-2-methyl-, methyl ester
CAS	103440-54-6
InChI	InChI=1S/C9H9IO2/c1-6-3-4-7(10)5-8(6)9(11)12-2/h3-5H,1-2H3

methyl 2-methyl-5-iodobenzoate - Physico-chemical Properties

Molecular Formula	C9H9IO2
Molar Mass	276.07
Density	1.666±0.06 g/cm3(Predicted)
Melting Point	60℃
Boling Point	290.4±28.0 °C(Predicted)
Storage Condition	2-8°C(protect from light)

methyl 2-methyl-5-iodobenzoate - Introduction

Methyl 5-iodo-2-methylbenzoate, chemical formula C9H9IO2, is an organic compound. It has the following properties:
1. appearance: colorless or yellow liquid.
2. solubility: insoluble in water, soluble in organic solvents such as alcohol, ether and ketone.
3. melting point: about 25-30 degrees Celsius.
4. vapor pressure: low, showing low volatility.
5. odor: with a special aromatic smell.

5-iodine -2-methyl benzoic acid methyl ester main uses include:
1. as an organic synthesis intermediate: it can be used to produce raw materials for organic compounds such as medicines and pesticides, and participate in a variety of organic synthesis reactions.
2. Can be used for research: Because of its special chemical structure and properties, it can also be used in the field of chemical research.

The method for preparing methyl 5-iodo -2-methyl benzoate is generally as follows:
Methyl 2-methylbenzoate is reacted with iodine in the presence of a suitable catalyst, for example, using acidic conditions. The reaction temperature is usually room temperature to boiling of the reaction mixture.

Need to pay attention to the safety information:
1. 5-iodine -2-methyl benzoic acid methyl ester is an organic compound, has certain toxicity, should be properly stored and used.
2. During operation, personal protective equipment should be worn, such as safety glasses, gloves and laboratory coats.
3. Prevent inhalation of gas, swallowing or contact with skin and eyes. Care should be taken to avoid contact and inhalation during use.
4. It is recommended to operate in a well-ventilated environment to avoid the accumulation of vapor.
5. Avoid contact with oxidants and strong acids to prevent dangerous reactions.

It should be emphasized that this information is for reference only, and the use and operation must be carried out in accordance with the specific circumstances and relevant safety instructions.

Last Update：2024-04-09 21:04:16